About 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine
2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine (PubChem CID 62580662) has the molecular formula C10H18N2S2
and a molecular weight of 230.40 g/mol. Its IUPAC name is 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine |
| PubChem CID | 62580662 |
| Molecular Formula | C10H18N2S2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine |
| SMILES | CC(C)CNCC(C)Sc1nccs1 |
| InChI | InChI=1S/C10H18N2S2/c1-8(2)6-11-7-9(3)14-10-12-4-5-13-10/h4-5,8-9,11H,6-7H2,1-3H3 |
| InChIKey | RNLYZJJHQSUOQI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine?
The IUPAC name of 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine (CID 62580662) is 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine.
What is the SMILES notation for 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine?
The canonical SMILES for 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine is CC(C)CNCC(C)Sc1nccs1.
What is the InChIKey of 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine?
The InChIKey is RNLYZJJHQSUOQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S2/c1-8(2)6-11-7-9(3)14-10-12-4-5-13-10/h4-5,8-9,11H,6-7H2,1-3H3.
What are the key properties of 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine?
2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine has a molecular weight of 230.40 g/mol, XLogP of 2.87, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[2-(1,3-thiazol-2-ylsulfanyl)propyl]propan-1-amine is sourced from PubChem (CID 62580662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).