About 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one
5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one (PubChem CID 62580707) has the molecular formula C10H6F3N3O4
and a molecular weight of 289.17 g/mol. Its IUPAC name is 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one.
Molecular Properties
| Compound Name | 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one |
| PubChem CID | 62580707 |
| Molecular Formula | C10H6F3N3O4 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one |
| SMILES | O=C(c1cn(Cc2cc(=O)c(O)co2)nn1)C(F)(F)F |
| InChI | InChI=1S/C10H6F3N3O4/c11-10(12,13)9(19)6-3-16(15-14-6)2-5-1-7(17)8(18)4-20-5/h1,3-4,18H,2H2 |
| InChIKey | WROHOXDNXNIDKV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one?
The IUPAC name of 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one (CID 62580707) is 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one.
What is the SMILES notation for 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one?
The canonical SMILES for 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one is O=C(c1cn(Cc2cc(=O)c(O)co2)nn1)C(F)(F)F.
What is the InChIKey of 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one?
The InChIKey is WROHOXDNXNIDKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F3N3O4/c11-10(12,13)9(19)6-3-16(15-14-6)2-5-1-7(17)8(18)4-20-5/h1,3-4,18H,2H2.
What are the key properties of 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one?
5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one has a molecular weight of 289.17 g/mol, XLogP of 0.73, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-[[4-(2,2,2-trifluoroacetyl)triazol-1-yl]methyl]pyran-4-one is sourced from PubChem (CID 62580707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).