C12H22N4S — CID 62581569
4-methyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]cyclohexan-1-amine (PubChem CID 62581569) has the molecular formula C12H22N4S and a molecular weight of 254.40 g/mol. Its IUPAC name is 4-methyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]cyclohexan-1-amine.
| Compound Name | 4-methyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 62581569 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 4-methyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]cyclohexan-1-amine |
| SMILES | Cc1nc(SCCNC2CCC(C)CC2)n[nH]1 |
| InChI | InChI=1S/C12H22N4S/c1-9-3-5-11(6-4-9)13-7-8-17-12-14-10(2)15-16-12/h9,11,13H,3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | UOAUQYWXPFSFRY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|