C9H18N4OS — CID 62581903
N',N'-dimethyl-N-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]ethane-1,2-diamine (PubChem CID 62581903) has the molecular formula C9H18N4OS and a molecular weight of 230.34 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62581903 |
| Molecular Formula | C9H18N4OS |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N',N'-dimethyl-N-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]ethane-1,2-diamine |
| SMILES | Cc1nnc(SCCNCCN(C)C)o1 |
| InChI | InChI=1S/C9H18N4OS/c1-8-11-12-9(14-8)15-7-5-10-4-6-13(2)3/h10H,4-7H2,1-3H3 |
| InChIKey | KHTKNQWKIZSGLY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|