C13H16F5NO — CID 62583041
N-[2-(2,3,4,5,6-pentafluorophenoxy)propyl]butan-1-amine (PubChem CID 62583041) has the molecular formula C13H16F5NO and a molecular weight of 297.27 g/mol. Its IUPAC name is N-[2-(2,3,4,5,6-pentafluorophenoxy)propyl]butan-1-amine.
| Compound Name | N-[2-(2,3,4,5,6-pentafluorophenoxy)propyl]butan-1-amine |
|---|---|
| PubChem CID | 62583041 |
| Molecular Formula | C13H16F5NO |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[2-(2,3,4,5,6-pentafluorophenoxy)propyl]butan-1-amine |
| SMILES | CCCCNCC(C)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H16F5NO/c1-3-4-5-19-6-7(2)20-13-11(17)9(15)8(14)10(16)12(13)18/h7,19H,3-6H2,1-2H3 |
| InChIKey | HPYQMSNIGJXANJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|