C14H23NO2S2 — CID 62583167
N-(2-methylsulfonylethyl)-2-(4-propan-2-ylphenyl)sulfanylethanamine (PubChem CID 62583167) has the molecular formula C14H23NO2S2 and a molecular weight of 301.48 g/mol. Its IUPAC name is N-(2-methylsulfonylethyl)-2-(4-propan-2-ylphenyl)sulfanylethanamine.
| Compound Name | N-(2-methylsulfonylethyl)-2-(4-propan-2-ylphenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 62583167 |
| Molecular Formula | C14H23NO2S2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-(2-methylsulfonylethyl)-2-(4-propan-2-ylphenyl)sulfanylethanamine |
| SMILES | CC(C)c1ccc(SCCNCCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H23NO2S2/c1-12(2)13-4-6-14(7-5-13)18-10-8-15-9-11-19(3,16)17/h4-7,12,15H,8-11H2,1-3H3 |
| InChIKey | MTKRJBNOAOQAMQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|