About N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine
N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine (PubChem CID 62585668) has the molecular formula C13H18N4S
and a molecular weight of 262.38 g/mol. Its IUPAC name is N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine |
| PubChem CID | 62585668 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine |
| SMILES | CNCC1CCCCN1c1ncnc2ccsc12 |
| InChI | InChI=1S/C13H18N4S/c1-14-8-10-4-2-3-6-17(10)13-12-11(5-7-18-12)15-9-16-13/h5,7,9-10,14H,2-4,6,8H2,1H3 |
| InChIKey | UAIBOTZLOBQAGJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine?
The IUPAC name of N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine (CID 62585668) is N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine.
What is the SMILES notation for N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine?
The canonical SMILES for N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine is CNCC1CCCCN1c1ncnc2ccsc12.
What is the InChIKey of N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine?
The InChIKey is UAIBOTZLOBQAGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4S/c1-14-8-10-4-2-3-6-17(10)13-12-11(5-7-18-12)15-9-16-13/h5,7,9-10,14H,2-4,6,8H2,1H3.
What are the key properties of N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine?
N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine has a molecular weight of 262.38 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-2-yl)methanamine is sourced from PubChem (CID 62585668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).