C24H31N3O7 — CID 6258702
N-[2-[(2Z)-2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4,5-triethoxybenzamide (PubChem CID 6258702) has the molecular formula C24H31N3O7 and a molecular weight of 473.53 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[2-[(2Z)-2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 6258702 |
| Molecular Formula | C24H31N3O7 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-[2-[(2Z)-2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCC(=O)N/N=C\c2cc(OC)ccc2OC)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H31N3O7/c1-6-32-20-12-16(13-21(33-7-2)23(20)34-8-3)24(29)25-15-22(28)27-26-14-17-11-18(30-4)9-10-19(17)31-5/h9-14H,6-8,15H2,1-5H3,(H,25,29)(H,27,28)/b26-14- |
| InChIKey | FWZHCESAXVJAJG-WGARJPEWSA-N |
| XLogP | 2.78 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|