C15H15N5S — CID 62587890
4-methyl-5-(8-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-1,3-thiazole (PubChem CID 62587890) has the molecular formula C15H15N5S and a molecular weight of 297.39 g/mol. Its IUPAC name is 4-methyl-5-(8-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-1,3-thiazole.
| Compound Name | 4-methyl-5-(8-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 62587890 |
| Molecular Formula | C15H15N5S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-methyl-5-(8-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-1,3-thiazole |
| SMILES | Cc1ncsc1-c1nnc2n1CCNC2c1ccccc1 |
| InChI | InChI=1S/C15H15N5S/c1-10-13(21-9-17-10)15-19-18-14-12(16-7-8-20(14)15)11-5-3-2-4-6-11/h2-6,9,12,16H,7-8H2,1H3 |
| InChIKey | BVZAUMBBTQSKMY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |