C15H21N3O2 — CID 62588294
(3aR,7aS)-2-(2-methyl-5-nitrophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 62588294) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (3aR,7aS)-2-(2-methyl-5-nitrophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aR,7aS)-2-(2-methyl-5-nitrophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 62588294 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (3aR,7aS)-2-(2-methyl-5-nitrophenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N1C[C@H]2CCC(N)C[C@H]2C1 |
| InChI | InChI=1S/C15H21N3O2/c1-10-2-5-14(18(19)20)7-15(10)17-8-11-3-4-13(16)6-12(11)9-17/h2,5,7,11-13H,3-4,6,8-9,16H2,1H3/t11-,12+,13?/m1/s1 |
| InChIKey | CJMVZEBIKCOFSW-OJRHAOMCSA-N |
| XLogP | 2.47 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|