C13H19ClN2O2 — CID 62588977
N-[(5-amino-2-chlorophenyl)methyl]-3-ethoxy-N-methylpropanamide (PubChem CID 62588977) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is N-[(5-amino-2-chlorophenyl)methyl]-3-ethoxy-N-methylpropanamide.
| Compound Name | N-[(5-amino-2-chlorophenyl)methyl]-3-ethoxy-N-methylpropanamide |
|---|---|
| PubChem CID | 62588977 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-[(5-amino-2-chlorophenyl)methyl]-3-ethoxy-N-methylpropanamide |
| SMILES | CCOCCC(=O)N(C)Cc1cc(N)ccc1Cl |
| InChI | InChI=1S/C13H19ClN2O2/c1-3-18-7-6-13(17)16(2)9-10-8-11(15)4-5-12(10)14/h4-5,8H,3,6-7,9,15H2,1-2H3 |
| InChIKey | BGBXKOSNPPEXGY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|