About 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid
2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid (PubChem CID 62589755) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid |
| PubChem CID | 62589755 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid |
| SMILES | CCOCCc1nc(C(=O)O)co1 |
| InChI | InChI=1S/C8H11NO4/c1-2-12-4-3-7-9-6(5-13-7)8(10)11/h5H,2-4H2,1H3,(H,10,11) |
| InChIKey | FBCVRYFJEYOOTQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid (CID 62589755) is 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid is CCOCCc1nc(C(=O)O)co1.
What is the InChIKey of 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid?
The InChIKey is FBCVRYFJEYOOTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4/c1-2-12-4-3-7-9-6(5-13-7)8(10)11/h5H,2-4H2,1H3,(H,10,11).
What are the key properties of 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid?
2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid has a molecular weight of 185.18 g/mol, XLogP of 0.95, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyethyl)-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 62589755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).