ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate

C12H21NO4 — CID 62590796

IUPACethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate
SMILESCCOC(=O)C1CCN(C(=O)CCOC)CC1
InChIInChI=1S/C12H21NO4/c1-3-17-12(15)10-4-7-13(8-5-10)11(14)6-9-16-2/h10H,3-9H2,1-2H3
InChIKeyZWMCSIGIFGIGII-UHFFFAOYSA-N
MW243.30 g/mol
LogP0.82
Rot. Bonds5

About ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate

ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate (PubChem CID 62590796) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate.

Molecular Properties

Compound Nameethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate
PubChem CID62590796
Molecular FormulaC12H21NO4
Molecular Weight243.30 g/mol
Exact Mass243.15
IUPAC Nameethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate
SMILESCCOC(=O)C1CCN(C(=O)CCOC)CC1
InChIInChI=1S/C12H21NO4/c1-3-17-12(15)10-4-7-13(8-5-10)11(14)6-9-16-2/h10H,3-9H2,1-2H3
InChIKeyZWMCSIGIFGIGII-UHFFFAOYSA-N
XLogP0.82
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.30
LogP ≤ 50.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate?
The IUPAC name of ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate (CID 62590796) is ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)CCOC)CC1.
What is the InChIKey of ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate?
The InChIKey is ZWMCSIGIFGIGII-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4/c1-3-17-12(15)10-4-7-13(8-5-10)11(14)6-9-16-2/h10H,3-9H2,1-2H3.
What are the key properties of ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate?
ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate has a molecular weight of 243.30 g/mol, XLogP of 0.82, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(3-methoxypropanoyl)piperidine-4-carboxylate is sourced from PubChem (CID 62590796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).