About N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine
N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine (PubChem CID 62591808) has the molecular formula C15H21N3O2S
and a molecular weight of 307.42 g/mol. Its IUPAC name is N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine |
| PubChem CID | 62591808 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1CCCN1C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C15H21N3O2S/c1-11(2)16-10-12-6-5-9-18(12)15-13-7-3-4-8-14(13)21(19,20)17-15/h3-4,7-8,11-12,16H,5-6,9-10H2,1-2H3 |
| InChIKey | MZKGDJFUYFEKPN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine?
The IUPAC name of N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine (CID 62591808) is N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine.
What is the SMILES notation for N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine?
The canonical SMILES for N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine is CC(C)NCC1CCCN1C1=NS(=O)(=O)c2ccccc21.
What is the InChIKey of N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine?
The InChIKey is MZKGDJFUYFEKPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2S/c1-11(2)16-10-12-6-5-9-18(12)15-13-7-3-4-8-14(13)21(19,20)17-15/h3-4,7-8,11-12,16H,5-6,9-10H2,1-2H3.
What are the key properties of N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine?
N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine has a molecular weight of 307.42 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidin-2-yl]methyl]propan-2-amine is sourced from PubChem (CID 62591808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).