C16H22BrFN2 — CID 62591864
N-[[1-[(2-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]cyclopropanamine (PubChem CID 62591864) has the molecular formula C16H22BrFN2 and a molecular weight of 341.27 g/mol. Its IUPAC name is N-[[1-[(2-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-[(2-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62591864 |
| Molecular Formula | C16H22BrFN2 |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[[1-[(2-bromo-4-fluorophenyl)methyl]piperidin-4-yl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(CN2CCC(CNC3CC3)CC2)c(Br)c1 |
| InChI | InChI=1S/C16H22BrFN2/c17-16-9-14(18)2-1-13(16)11-20-7-5-12(6-8-20)10-19-15-3-4-15/h1-2,9,12,15,19H,3-8,10-11H2 |
| InChIKey | XQILCWZXHNWCRX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |