About (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine
(2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine (PubChem CID 62592472) has the molecular formula C16H16N4S
and a molecular weight of 296.40 g/mol. Its IUPAC name is (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine.
Molecular Properties
| Compound Name | (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine |
| PubChem CID | 62592472 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine |
| SMILES | NCC1Cc2ccccc2CN1c1ncnc2ccsc12 |
| InChI | InChI=1S/C16H16N4S/c17-8-13-7-11-3-1-2-4-12(11)9-20(13)16-15-14(5-6-21-15)18-10-19-16/h1-6,10,13H,7-9,17H2 |
| InChIKey | ZBUFDXXDEUQJRH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine?
The IUPAC name of (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine (CID 62592472) is (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine.
What is the SMILES notation for (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine?
The canonical SMILES for (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine is NCC1Cc2ccccc2CN1c1ncnc2ccsc12.
What is the InChIKey of (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine?
The InChIKey is ZBUFDXXDEUQJRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4S/c17-8-13-7-11-3-1-2-4-12(11)9-20(13)16-15-14(5-6-21-15)18-10-19-16/h1-6,10,13H,7-9,17H2.
What are the key properties of (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine?
(2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine has a molecular weight of 296.40 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-thieno[3,2-d]pyrimidin-4-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine is sourced from PubChem (CID 62592472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).