About (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine
(2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine (PubChem CID 62592822) has the molecular formula C14H16N4
and a molecular weight of 240.31 g/mol. Its IUPAC name is (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine.
Molecular Properties
| Compound Name | (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine |
| PubChem CID | 62592822 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine |
| SMILES | NCC1Cc2ccccc2CN1c1cccnn1 |
| InChI | InChI=1S/C14H16N4/c15-9-13-8-11-4-1-2-5-12(11)10-18(13)14-6-3-7-16-17-14/h1-7,13H,8-10,15H2 |
| InChIKey | FOUALOBEZQPJEZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine?
The IUPAC name of (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine (CID 62592822) is (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine.
What is the SMILES notation for (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine?
The canonical SMILES for (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine is NCC1Cc2ccccc2CN1c1cccnn1.
What is the InChIKey of (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine?
The InChIKey is FOUALOBEZQPJEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4/c15-9-13-8-11-4-1-2-5-12(11)10-18(13)14-6-3-7-16-17-14/h1-7,13H,8-10,15H2.
What are the key properties of (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine?
(2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine has a molecular weight of 240.31 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyridazin-3-yl-3,4-dihydro-1H-isoquinolin-3-yl)methanamine is sourced from PubChem (CID 62592822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).