About N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine
N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine (PubChem CID 62593196) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine |
| PubChem CID | 62593196 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine |
| SMILES | CCCNCCN(C)c1cc(C)nc(C)n1 |
| InChI | InChI=1S/C12H22N4/c1-5-6-13-7-8-16(4)12-9-10(2)14-11(3)15-12/h9,13H,5-8H2,1-4H3 |
| InChIKey | SYRNEBIPPAVMEH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine?
The IUPAC name of N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine (CID 62593196) is N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine.
What is the SMILES notation for N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine?
The canonical SMILES for N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine is CCCNCCN(C)c1cc(C)nc(C)n1.
What is the InChIKey of N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine?
The InChIKey is SYRNEBIPPAVMEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4/c1-5-6-13-7-8-16(4)12-9-10(2)14-11(3)15-12/h9,13H,5-8H2,1-4H3.
What are the key properties of N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine?
N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine has a molecular weight of 222.34 g/mol, XLogP of 1.53, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,6-dimethylpyrimidin-4-yl)-N'-methyl-N-propylethane-1,2-diamine is sourced from PubChem (CID 62593196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).