C16H24BrFN2O — CID 62593610
N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]methyl]-2-methoxyethanamine (PubChem CID 62593610) has the molecular formula C16H24BrFN2O and a molecular weight of 359.28 g/mol. Its IUPAC name is N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 62593610 |
| Molecular Formula | C16H24BrFN2O |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[[1-[(3-bromo-4-fluorophenyl)methyl]piperidin-3-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCC1CCCN(Cc2ccc(F)c(Br)c2)C1 |
| InChI | InChI=1S/C16H24BrFN2O/c1-21-8-6-19-10-14-3-2-7-20(12-14)11-13-4-5-16(18)15(17)9-13/h4-5,9,14,19H,2-3,6-8,10-12H2,1H3 |
| InChIKey | KQVZHNNKMVWJAN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|