C12H14FN3O — CID 62594660
3-[(3-fluorophenyl)methyl]-N-propyl-1,2,4-oxadiazol-5-amine (PubChem CID 62594660) has the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl]-N-propyl-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-[(3-fluorophenyl)methyl]-N-propyl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 62594660 |
| Molecular Formula | C12H14FN3O |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl]-N-propyl-1,2,4-oxadiazol-5-amine |
| SMILES | CCCNc1nc(Cc2cccc(F)c2)no1 |
| InChI | InChI=1S/C12H14FN3O/c1-2-6-14-12-15-11(16-17-12)8-9-4-3-5-10(13)7-9/h3-5,7H,2,6,8H2,1H3,(H,14,15,16) |
| InChIKey | XPGUPCWPSMHZAS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |