C8H9N5O — CID 62596515
[3-(pyridin-2-ylmethyl)-1,2,4-oxadiazol-5-yl]hydrazine (PubChem CID 62596515) has the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. Its IUPAC name is [3-(pyridin-2-ylmethyl)-1,2,4-oxadiazol-5-yl]hydrazine.
| Compound Name | [3-(pyridin-2-ylmethyl)-1,2,4-oxadiazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 62596515 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | [3-(pyridin-2-ylmethyl)-1,2,4-oxadiazol-5-yl]hydrazine |
| SMILES | NNc1nc(Cc2ccccn2)no1 |
| InChI | InChI=1S/C8H9N5O/c9-12-8-11-7(13-14-8)5-6-3-1-2-4-10-6/h1-4H,5,9H2,(H,11,12,13) |
| InChIKey | KLUMKTQQTRDWFZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|