C14H23NO3 — CID 62597582
N-[2-(3,5-dimethoxyphenoxy)ethyl]butan-1-amine (PubChem CID 62597582) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyphenoxy)ethyl]butan-1-amine.
| Compound Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 62597582 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]butan-1-amine |
| SMILES | CCCCNCCOc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C14H23NO3/c1-4-5-6-15-7-8-18-14-10-12(16-2)9-13(11-14)17-3/h9-11,15H,4-8H2,1-3H3 |
| InChIKey | ILOMKHFUOUPZTD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|