C14H7Cl2NO2 — CID 625977
2-(3,4-dichlorophenyl)-3,1-benzoxazin-4-one (PubChem CID 625977) has the molecular formula C14H7Cl2NO2 and a molecular weight of 292.12 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-3,1-benzoxazin-4-one.
| Compound Name | 2-(3,4-dichlorophenyl)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 625977 |
| Molecular Formula | C14H7Cl2NO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C14H7Cl2NO2/c15-10-6-5-8(7-11(10)16)13-17-12-4-2-1-3-9(12)14(18)19-13/h1-7H |
| InChIKey | YFTNZCJAUKLNBY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |