About 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine
4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine (PubChem CID 625981) has the molecular formula C19H17NS
and a molecular weight of 291.42 g/mol. Its IUPAC name is 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine.
Molecular Properties
| Compound Name | 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine |
| PubChem CID | 625981 |
| Molecular Formula | C19H17NS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine |
| SMILES | CC1=C2Sc3ccccc3N=C2CC(c2ccccc2)C1 |
| InChI | InChI=1S/C19H17NS/c1-13-11-15(14-7-3-2-4-8-14)12-17-19(13)21-18-10-6-5-9-16(18)20-17/h2-10,15H,11-12H2,1H3 |
| InChIKey | ANSPDQHDLOLLFD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine?
The IUPAC name of 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine (CID 625981) is 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine.
What is the SMILES notation for 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine?
The canonical SMILES for 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine is CC1=C2Sc3ccccc3N=C2CC(c2ccccc2)C1.
What is the InChIKey of 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine?
The InChIKey is ANSPDQHDLOLLFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NS/c1-13-11-15(14-7-3-2-4-8-14)12-17-19(13)21-18-10-6-5-9-16(18)20-17/h2-10,15H,11-12H2,1H3.
What are the key properties of 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine?
4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine has a molecular weight of 291.42 g/mol, XLogP of 5.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-phenyl-2,3-dihydro-1H-phenothiazine is sourced from PubChem (CID 625981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).