About 4-nitro-2,6-diphenylphenol
4-nitro-2,6-diphenylphenol (PubChem CID 625985) has the molecular formula C18H13NO3
and a molecular weight of 291.31 g/mol. Its IUPAC name is 4-nitro-2,6-diphenylphenol.
Molecular Properties
| Compound Name | 4-nitro-2,6-diphenylphenol |
| PubChem CID | 625985 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-nitro-2,6-diphenylphenol |
| SMILES | O=[N+]([O-])c1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H13NO3/c20-18-16(13-7-3-1-4-8-13)11-15(19(21)22)12-17(18)14-9-5-2-6-10-14/h1-12,20H |
| InChIKey | YCXQKJXTGDYKIO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-2,6-diphenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-2,6-diphenylphenol?
The IUPAC name of 4-nitro-2,6-diphenylphenol (CID 625985) is 4-nitro-2,6-diphenylphenol.
What is the SMILES notation for 4-nitro-2,6-diphenylphenol?
The canonical SMILES for 4-nitro-2,6-diphenylphenol is O=[N+]([O-])c1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1.
What is the InChIKey of 4-nitro-2,6-diphenylphenol?
The InChIKey is YCXQKJXTGDYKIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO3/c20-18-16(13-7-3-1-4-8-13)11-15(19(21)22)12-17(18)14-9-5-2-6-10-14/h1-12,20H.
What are the key properties of 4-nitro-2,6-diphenylphenol?
4-nitro-2,6-diphenylphenol has a molecular weight of 291.31 g/mol, XLogP of 4.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-2,6-diphenylphenol is sourced from PubChem (CID 625985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).