C26H24N6O2 — CID 6259954
6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine (PubChem CID 6259954) has the molecular formula C26H24N6O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is 6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine.
| Compound Name | 6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 6259954 |
| Molecular Formula | C26H24N6O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-5-nitro-2-N,4-N-diphenylpyrimidine-2,4-diamine |
| SMILES | CN(C)c1ccc(/C=C/c2nc(Nc3ccccc3)nc(Nc3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H24N6O2/c1-31(2)22-16-13-19(14-17-22)15-18-23-24(32(33)34)25(27-20-9-5-3-6-10-20)30-26(29-23)28-21-11-7-4-8-12-21/h3-18H,1-2H3,(H2,27,28,29,30)/b18-15+ |
| InChIKey | DMLOEBAFQCNNHL-OBGWFSINSA-N |
| XLogP | 6.11 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|