About (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one
(3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one (PubChem CID 6260042) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one.
Molecular Properties
| Compound Name | (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one |
| PubChem CID | 6260042 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one |
| SMILES | CC(C)(C)C(=O)/C=C1/NCCNC1=O |
| InChI | InChI=1S/C10H16N2O2/c1-10(2,3)8(13)6-7-9(14)12-5-4-11-7/h6,11H,4-5H2,1-3H3,(H,12,14)/b7-6+ |
| InChIKey | PTQKFCRFHKKTDI-VOTSOKGWSA-N |
| XLogP | 0.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one?
The IUPAC name of (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one (CID 6260042) is (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one.
What is the SMILES notation for (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one?
The canonical SMILES for (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one is CC(C)(C)C(=O)/C=C1/NCCNC1=O.
What is the InChIKey of (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one?
The InChIKey is PTQKFCRFHKKTDI-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-10(2,3)8(13)6-7-9(14)12-5-4-11-7/h6,11H,4-5H2,1-3H3,(H,12,14)/b7-6+.
What are the key properties of (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one?
(3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one has a molecular weight of 196.25 g/mol, XLogP of 0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(3,3-dimethyl-2-oxobutylidene)piperazin-2-one is sourced from PubChem (CID 6260042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).