C12H17BrFN — CID 62601740
1-(4-bromo-2-fluorophenyl)-N-propylpropan-2-amine (PubChem CID 62601740) has the molecular formula C12H17BrFN and a molecular weight of 274.18 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-N-propylpropan-2-amine.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 62601740 |
| Molecular Formula | C12H17BrFN |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-N-propylpropan-2-amine |
| SMILES | CCCNC(C)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H17BrFN/c1-3-6-15-9(2)7-10-4-5-11(13)8-12(10)14/h4-5,8-9,15H,3,6-7H2,1-2H3 |
| InChIKey | JHFLNOUYZNGBBU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |