C11H6F4N2S — CID 6260448
2,3,5,6-tetrafluoro-N-[(Z)-thiophen-2-ylmethylideneamino]aniline (PubChem CID 6260448) has the molecular formula C11H6F4N2S and a molecular weight of 274.24 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(Z)-thiophen-2-ylmethylideneamino]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(Z)-thiophen-2-ylmethylideneamino]aniline |
|---|---|
| PubChem CID | 6260448 |
| Molecular Formula | C11H6F4N2S |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(Z)-thiophen-2-ylmethylideneamino]aniline |
| SMILES | Fc1cc(F)c(F)c(N/N=C\c2cccs2)c1F |
| InChI | InChI=1S/C11H6F4N2S/c12-7-4-8(13)10(15)11(9(7)14)17-16-5-6-2-1-3-18-6/h1-5,17H/b16-5- |
| InChIKey | JAJCXQCQUWODEG-BNCCVWRVSA-N |
| XLogP | 3.75 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_B(4)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|