C12H16BrFO — CID 62606118
1-(2-bromo-5-fluorophenyl)-4-methylpentan-2-ol (PubChem CID 62606118) has the molecular formula C12H16BrFO and a molecular weight of 275.16 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-4-methylpentan-2-ol.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 62606118 |
| Molecular Formula | C12H16BrFO |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-4-methylpentan-2-ol |
| SMILES | CC(C)CC(O)Cc1cc(F)ccc1Br |
| InChI | InChI=1S/C12H16BrFO/c1-8(2)5-11(15)7-9-6-10(14)3-4-12(9)13/h3-4,6,8,11,15H,5,7H2,1-2H3 |
| InChIKey | MTORFTQSWZRIKI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |