C12H10Cl2N2O — CID 62606143
2-(2,6-dichlorophenyl)-1-pyrimidin-2-ylethanol (PubChem CID 62606143) has the molecular formula C12H10Cl2N2O and a molecular weight of 269.13 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-pyrimidin-2-ylethanol.
| Compound Name | 2-(2,6-dichlorophenyl)-1-pyrimidin-2-ylethanol |
|---|---|
| PubChem CID | 62606143 |
| Molecular Formula | C12H10Cl2N2O |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-pyrimidin-2-ylethanol |
| SMILES | OC(Cc1c(Cl)cccc1Cl)c1ncccn1 |
| InChI | InChI=1S/C12H10Cl2N2O/c13-9-3-1-4-10(14)8(9)7-11(17)12-15-5-2-6-16-12/h1-6,11,17H,7H2 |
| InChIKey | FFFZYPWGGVAQSV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |