About 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol
1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol (PubChem CID 62607279) has the molecular formula C8H8ClF3OS
and a molecular weight of 244.67 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol.
Molecular Properties
| Compound Name | 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol |
| PubChem CID | 62607279 |
| Molecular Formula | C8H8ClF3OS |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol |
| SMILES | OC(Cc1ccc(Cl)s1)CC(F)(F)F |
| InChI | InChI=1S/C8H8ClF3OS/c9-7-2-1-6(14-7)3-5(13)4-8(10,11)12/h1-2,5,13H,3-4H2 |
| InChIKey | FXGHOGATJOJTRT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol?
The IUPAC name of 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol (CID 62607279) is 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol.
What is the SMILES notation for 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol?
The canonical SMILES for 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol is OC(Cc1ccc(Cl)s1)CC(F)(F)F.
What is the InChIKey of 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol?
The InChIKey is FXGHOGATJOJTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClF3OS/c9-7-2-1-6(14-7)3-5(13)4-8(10,11)12/h1-2,5,13H,3-4H2.
What are the key properties of 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol?
1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol has a molecular weight of 244.67 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chlorothiophen-2-yl)-4,4,4-trifluorobutan-2-ol is sourced from PubChem (CID 62607279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).