C16H18FNO2 — CID 62607710
2-(3-fluoro-4-methoxyphenyl)-1-(3-methoxyphenyl)ethanamine (PubChem CID 62607710) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-1-(3-methoxyphenyl)ethanamine.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-1-(3-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 62607710 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-1-(3-methoxyphenyl)ethanamine |
| SMILES | COc1cccc(C(N)Cc2ccc(OC)c(F)c2)c1 |
| InChI | InChI=1S/C16H18FNO2/c1-19-13-5-3-4-12(10-13)15(18)9-11-6-7-16(20-2)14(17)8-11/h3-8,10,15H,9,18H2,1-2H3 |
| InChIKey | BJMXVWHWNWUJTP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |