C33H32ClN5O2S — CID 6260920
(5Z)-2-(4-benzylpiperazin-1-yl)-5-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 6260920) has the molecular formula C33H32ClN5O2S and a molecular weight of 598.17 g/mol. Its IUPAC name is (5Z)-2-(4-benzylpiperazin-1-yl)-5-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-(4-benzylpiperazin-1-yl)-5-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 6260920 |
| Molecular Formula | C33H32ClN5O2S |
| Molecular Weight | 598.17 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | (5Z)-2-(4-benzylpiperazin-1-yl)-5-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\SC(N3CCN(Cc4ccccc4)CC3)=NC2=O)cc1Cl |
| InChI | InChI=1S/C33H32ClN5O2S/c1-2-19-41-29-14-13-25(20-28(29)34)31-26(23-39(36-31)27-11-7-4-8-12-27)21-30-32(40)35-33(42-30)38-17-15-37(16-18-38)22-24-9-5-3-6-10-24/h3-14,20-21,23H,2,15-19,22H2,1H3/b30-21- |
| InChIKey | QXDWMRRIRLHDST-OFWBYEQRSA-N |
| XLogP | 6.77 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.17 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|