About 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one
4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one (PubChem CID 62612717) has the molecular formula C15H27NO2S
and a molecular weight of 285.45 g/mol. Its IUPAC name is 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one |
| PubChem CID | 62612717 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one |
| SMILES | CC(C)(C)C1CCC(=O)C(CN2CCS(=O)CC2)C1 |
| InChI | InChI=1S/C15H27NO2S/c1-15(2,3)13-4-5-14(17)12(10-13)11-16-6-8-19(18)9-7-16/h12-13H,4-11H2,1-3H3 |
| InChIKey | LFNPRSLZHGTKHG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one?
The IUPAC name of 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one (CID 62612717) is 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one.
What is the SMILES notation for 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one?
The canonical SMILES for 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one is CC(C)(C)C1CCC(=O)C(CN2CCS(=O)CC2)C1.
What is the InChIKey of 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one?
The InChIKey is LFNPRSLZHGTKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2S/c1-15(2,3)13-4-5-14(17)12(10-13)11-16-6-8-19(18)9-7-16/h12-13H,4-11H2,1-3H3.
What are the key properties of 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one?
4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one has a molecular weight of 285.45 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]cyclohexan-1-one is sourced from PubChem (CID 62612717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).