C13H16N4O4 — CID 626130
5-(3,4,5-trimethoxyphenoxy)pyrimidine-2,4-diamine (PubChem CID 626130) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 5-(3,4,5-trimethoxyphenoxy)pyrimidine-2,4-diamine.
| Compound Name | 5-(3,4,5-trimethoxyphenoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 626130 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 5-(3,4,5-trimethoxyphenoxy)pyrimidine-2,4-diamine |
| SMILES | COc1cc(Oc2cnc(N)nc2N)cc(OC)c1OC |
| InChI | InChI=1S/C13H16N4O4/c1-18-8-4-7(5-9(19-2)11(8)20-3)21-10-6-16-13(15)17-12(10)14/h4-6H,1-3H3,(H4,14,15,16,17) |
| InChIKey | WSHKDTFPTISQBN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |