C15H27NOS — CID 62613061
4-propyl-2-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-one (PubChem CID 62613061) has the molecular formula C15H27NOS and a molecular weight of 269.45 g/mol. Its IUPAC name is 4-propyl-2-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-one.
| Compound Name | 4-propyl-2-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 62613061 |
| Molecular Formula | C15H27NOS |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 4-propyl-2-(1,4-thiazepan-4-ylmethyl)cyclohexan-1-one |
| SMILES | CCCC1CCC(=O)C(CN2CCCSCC2)C1 |
| InChI | InChI=1S/C15H27NOS/c1-2-4-13-5-6-15(17)14(11-13)12-16-7-3-9-18-10-8-16/h13-14H,2-12H2,1H3 |
| InChIKey | VFFZKOBHIAWANT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |