About 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one
2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one (PubChem CID 62613370) has the molecular formula C14H24F3NO
and a molecular weight of 279.35 g/mol. Its IUPAC name is 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one.
Molecular Properties
| Compound Name | 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one |
| PubChem CID | 62613370 |
| Molecular Formula | C14H24F3NO |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one |
| SMILES | CCCC1CCC(=O)C(CN(CC)CC(F)(F)F)C1 |
| InChI | InChI=1S/C14H24F3NO/c1-3-5-11-6-7-13(19)12(8-11)9-18(4-2)10-14(15,16)17/h11-12H,3-10H2,1-2H3 |
| InChIKey | LAWISIQYWDKVRP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one?
The IUPAC name of 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one (CID 62613370) is 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one.
What is the SMILES notation for 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one?
The canonical SMILES for 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one is CCCC1CCC(=O)C(CN(CC)CC(F)(F)F)C1.
What is the InChIKey of 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one?
The InChIKey is LAWISIQYWDKVRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24F3NO/c1-3-5-11-6-7-13(19)12(8-11)9-18(4-2)10-14(15,16)17/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one?
2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one has a molecular weight of 279.35 g/mol, XLogP of 3.66, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-4-propylcyclohexan-1-one is sourced from PubChem (CID 62613370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).