About 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one
2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one (PubChem CID 62613854) has the molecular formula C15H27NO3S
and a molecular weight of 301.45 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one.
Molecular Properties
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one |
| PubChem CID | 62613854 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one |
| SMILES | CCCC1CCC(=O)C(CN(C)C2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C15H27NO3S/c1-3-4-12-5-6-15(17)13(9-12)10-16(2)14-7-8-20(18,19)11-14/h12-14H,3-11H2,1-2H3 |
| InChIKey | GYONLAJNMDRAGU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one?
The IUPAC name of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one (CID 62613854) is 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one.
What is the SMILES notation for 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one?
The canonical SMILES for 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one is CCCC1CCC(=O)C(CN(C)C2CCS(=O)(=O)C2)C1.
What is the InChIKey of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one?
The InChIKey is GYONLAJNMDRAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3S/c1-3-4-12-5-6-15(17)13(9-12)10-16(2)14-7-8-20(18,19)11-14/h12-14H,3-11H2,1-2H3.
What are the key properties of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one?
2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one has a molecular weight of 301.45 g/mol, XLogP of 1.89, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-4-propylcyclohexan-1-one is sourced from PubChem (CID 62613854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).