C22H21F4N3O3 — CID 6261595
N-[(Z)-1-[4-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-3-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 6261595) has the molecular formula C22H21F4N3O3 and a molecular weight of 451.42 g/mol. Its IUPAC name is N-[(Z)-1-[4-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-3-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-[(Z)-1-[4-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-3-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 6261595 |
| Molecular Formula | C22H21F4N3O3 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-[(Z)-1-[4-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-3-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | C/C(=N/NC(=O)c1cccc(OC(F)(F)C(F)F)c1)c1ccc(NC(=O)C2CCC2)cc1 |
| InChI | InChI=1S/C22H21F4N3O3/c1-13(14-8-10-17(11-9-14)27-19(30)15-4-2-5-15)28-29-20(31)16-6-3-7-18(12-16)32-22(25,26)21(23)24/h3,6-12,15,21H,2,4-5H2,1H3,(H,27,30)(H,29,31)/b28-13- |
| InChIKey | IIHDOQOYZIQDJC-QDTIIGTASA-N |
| XLogP | 4.82 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|