About 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine
1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine (PubChem CID 62619148) has the molecular formula C17H28BrN3
and a molecular weight of 354.34 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine |
| PubChem CID | 62619148 |
| Molecular Formula | C17H28BrN3 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine |
| SMILES | CNC(CCN(C)C1CCCN(C)C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H28BrN3/c1-19-17(14-6-8-15(18)9-7-14)10-12-21(3)16-5-4-11-20(2)13-16/h6-9,16-17,19H,4-5,10-13H2,1-3H3 |
| InChIKey | XFDCLRYUVAYLIQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine?
The IUPAC name of 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine (CID 62619148) is 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine.
What is the SMILES notation for 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine?
The canonical SMILES for 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine is CNC(CCN(C)C1CCCN(C)C1)c1ccc(Br)cc1.
What is the InChIKey of 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine?
The InChIKey is XFDCLRYUVAYLIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28BrN3/c1-19-17(14-6-8-15(18)9-7-14)10-12-21(3)16-5-4-11-20(2)13-16/h6-9,16-17,19H,4-5,10-13H2,1-3H3.
What are the key properties of 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine?
1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine has a molecular weight of 354.34 g/mol, XLogP of 3.13, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-N,N'-dimethyl-N'-(1-methylpiperidin-3-yl)propane-1,3-diamine is sourced from PubChem (CID 62619148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).