C20H23NO — CID 626194
N-(6-tricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaenyl)acetamide (PubChem CID 626194) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is N-(6-tricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaenyl)acetamide.
| Compound Name | N-(6-tricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaenyl)acetamide |
|---|---|
| PubChem CID | 626194 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-(6-tricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaenyl)acetamide |
| SMILES | CC(=O)Nc1cc2ccc1CCCc1ccc(cc1)CCC2 |
| InChI | InChI=1S/C20H23NO/c1-15(22)21-20-14-18-6-2-4-16-8-10-17(11-9-16)5-3-7-19(20)13-12-18/h8-14H,2-7H2,1H3,(H,21,22) |
| InChIKey | GWQROEQTLXQFKH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |