C12H11F3O2 — CID 62620228
1-cyclopropyl-2-[4-(trifluoromethoxy)phenyl]ethanone (PubChem CID 62620228) has the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 1-cyclopropyl-2-[4-(trifluoromethoxy)phenyl]ethanone.
| Compound Name | 1-cyclopropyl-2-[4-(trifluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 62620228 |
| Molecular Formula | C12H11F3O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-cyclopropyl-2-[4-(trifluoromethoxy)phenyl]ethanone |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C12H11F3O2/c13-12(14,15)17-10-5-1-8(2-6-10)7-11(16)9-3-4-9/h1-2,5-6,9H,3-4,7H2 |
| InChIKey | NLNWKQYUROAAMP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |