C13H16F3NO — CID 62622356
2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-dihydroinden-2-amine (PubChem CID 62622356) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-dihydroinden-2-amine.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-dihydroinden-2-amine |
|---|---|
| PubChem CID | 62622356 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-dihydroinden-2-amine |
| SMILES | NC1(CCOCC(F)(F)F)Cc2ccccc2C1 |
| InChI | InChI=1S/C13H16F3NO/c14-13(15,16)9-18-6-5-12(17)7-10-3-1-2-4-11(10)8-12/h1-4H,5-9,17H2 |
| InChIKey | QNEBYAVBLDRJIG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|