C17H19NO — CID 62622533
2-(2-phenoxyethyl)-1,3-dihydroinden-2-amine (PubChem CID 62622533) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-(2-phenoxyethyl)-1,3-dihydroinden-2-amine.
| Compound Name | 2-(2-phenoxyethyl)-1,3-dihydroinden-2-amine |
|---|---|
| PubChem CID | 62622533 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-(2-phenoxyethyl)-1,3-dihydroinden-2-amine |
| SMILES | NC1(CCOc2ccccc2)Cc2ccccc2C1 |
| InChI | InChI=1S/C17H19NO/c18-17(10-11-19-16-8-2-1-3-9-16)12-14-6-4-5-7-15(14)13-17/h1-9H,10-13,18H2 |
| InChIKey | UTOODQVEOUCLJW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |