C14H18F3NO — CID 62622718
2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydroinden-2-amine (PubChem CID 62622718) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydroinden-2-amine.
| Compound Name | 2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydroinden-2-amine |
|---|---|
| PubChem CID | 62622718 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-[3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydroinden-2-amine |
| SMILES | NC1(CCCOCC(F)(F)F)Cc2ccccc2C1 |
| InChI | InChI=1S/C14H18F3NO/c15-14(16,17)10-19-7-3-6-13(18)8-11-4-1-2-5-12(11)9-13/h1-2,4-5H,3,6-10,18H2 |
| InChIKey | QODRHQAFAJKLOB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|