C13H12Cl2FNS — CID 62622766
2-(2,4-dichloro-5-fluorophenyl)-1-thiophen-3-ylpropan-2-amine (PubChem CID 62622766) has the molecular formula C13H12Cl2FNS and a molecular weight of 304.22 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-1-thiophen-3-ylpropan-2-amine.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-1-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 62622766 |
| Molecular Formula | C13H12Cl2FNS |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-1-thiophen-3-ylpropan-2-amine |
| SMILES | CC(N)(Cc1ccsc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl2FNS/c1-13(17,6-8-2-3-18-7-8)9-4-12(16)11(15)5-10(9)14/h2-5,7H,6,17H2,1H3 |
| InChIKey | IPDLACHCMITHBY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|