C17H17F3N2O4 — CID 6262318
methyl 4-[[1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carbonyl]amino]benzoate (PubChem CID 6262318) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is methyl 4-[[1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 6262318 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | methyl 4-[[1-[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]pyrrolidine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CCCN2/C=C/C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3N2O4/c1-26-16(25)11-4-6-12(7-5-11)21-15(24)13-3-2-9-22(13)10-8-14(23)17(18,19)20/h4-8,10,13H,2-3,9H2,1H3,(H,21,24)/b10-8+ |
| InChIKey | UVNYFOSWJHXILN-CSKARUKUSA-N |
| XLogP | 2.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|