C13H25NO2 — CID 62623866
1-(2-ethylmorpholin-4-yl)-4,4-dimethylpentan-3-one (PubChem CID 62623866) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-(2-ethylmorpholin-4-yl)-4,4-dimethylpentan-3-one.
| Compound Name | 1-(2-ethylmorpholin-4-yl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 62623866 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 1-(2-ethylmorpholin-4-yl)-4,4-dimethylpentan-3-one |
| SMILES | CCC1CN(CCC(=O)C(C)(C)C)CCO1 |
| InChI | InChI=1S/C13H25NO2/c1-5-11-10-14(8-9-16-11)7-6-12(15)13(2,3)4/h11H,5-10H2,1-4H3 |
| InChIKey | FEAQUDJIJCJRJL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |