C14H30N2 — CID 62624076
1-(3-ethylpiperidin-1-yl)-4,4-dimethylpentan-3-amine (PubChem CID 62624076) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 1-(3-ethylpiperidin-1-yl)-4,4-dimethylpentan-3-amine.
| Compound Name | 1-(3-ethylpiperidin-1-yl)-4,4-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 62624076 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 1-(3-ethylpiperidin-1-yl)-4,4-dimethylpentan-3-amine |
| SMILES | CCC1CCCN(CCC(N)C(C)(C)C)C1 |
| InChI | InChI=1S/C14H30N2/c1-5-12-7-6-9-16(11-12)10-8-13(15)14(2,3)4/h12-13H,5-11,15H2,1-4H3 |
| InChIKey | TVGKDWGVJZIJGA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |